C17H15N3O4S — CID 148930754
5-[(4-amino-3-methoxyphenyl)diazenyl]naphthalene-1-sulfonic acid (PubChem CID 148930754) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is 5-[(4-amino-3-methoxyphenyl)diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 5-[(4-amino-3-methoxyphenyl)diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 148930754 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 5-[(4-amino-3-methoxyphenyl)diazenyl]naphthalene-1-sulfonic acid |
| SMILES | COc1cc(/N=N/c2cccc3c(S(=O)(=O)O)cccc23)ccc1N |
| InChI | InChI=1S/C17H15N3O4S/c1-24-16-10-11(8-9-14(16)18)19-20-15-6-2-5-13-12(15)4-3-7-17(13)25(21,22)23/h2-10H,18H2,1H3,(H,21,22,23)/b20-19+ |
| InChIKey | PLXAFTYXKMFTMV-FMQUCBEESA-N |
| XLogP | 4.09 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|