C33H25N7O11S3 — CID 136646692
6-amino-4-hydroxy-3-[[4-[[2-methoxy-4-[(3-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136646692) has the molecular formula C33H25N7O11S3 and a molecular weight of 791.80 g/mol. Its IUPAC name is 6-amino-4-hydroxy-3-[[4-[[2-methoxy-4-[(3-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 6-amino-4-hydroxy-3-[[4-[[2-methoxy-4-[(3-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136646692 |
| Molecular Formula | C33H25N7O11S3 |
| Molecular Weight | 791.80 g/mol |
| Exact Mass | 791.08 |
| IUPAC Name | 6-amino-4-hydroxy-3-[[4-[[2-methoxy-4-[(3-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalen-1-yl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | COc1cc(/N=N/c2cccc(S(=O)(=O)O)c2)ccc1/N=N/c1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(N)cc3c2O)c2ccccc12 |
| InChI | InChI=1S/C33H25N7O11S3/c1-51-29-16-20(36-35-19-5-4-6-21(15-19)52(42,43)44)9-10-28(29)39-37-26-11-12-27(23-8-3-2-7-22(23)26)38-40-32-31(54(48,49)50)14-18-13-30(53(45,46)47)25(34)17-24(18)33(32)41/h2-17,41H,34H2,1H3,(H,42,43,44)(H,45,46,47)(H,48,49,50)/b36-35+,39-37+,40-38+ |
| InChIKey | WWUAFTCSTWRKIL-XHWYAENGSA-N |
| XLogP | 8.28 |
| TPSA | 292.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.80 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|