C32H27N7O11S2 — CID 136618008
2-[2-[[7-[(4-amino-2-methoxyphenyl)diazenyl]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]-4-methyl-5-[(3-sulfophenyl)diazenyl]phenoxy]acetic acid (PubChem CID 136618008) has the molecular formula C32H27N7O11S2 and a molecular weight of 749.74 g/mol. Its IUPAC name is 2-[2-[[7-[(4-amino-2-methoxyphenyl)diazenyl]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]-4-methyl-5-[(3-sulfophenyl)diazenyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[7-[(4-amino-2-methoxyphenyl)diazenyl]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]-4-methyl-5-[(3-sulfophenyl)diazenyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 136618008 |
| Molecular Formula | C32H27N7O11S2 |
| Molecular Weight | 749.74 g/mol |
| Exact Mass | 749.12 |
| IUPAC Name | 2-[2-[[7-[(4-amino-2-methoxyphenyl)diazenyl]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]-4-methyl-5-[(3-sulfophenyl)diazenyl]phenoxy]acetic acid |
| SMILES | COc1cc(N)ccc1/N=N/c1ccc2cc(S(=O)(=O)O)c(/N=N/c3cc(C)c(/N=N/c4cccc(S(=O)(=O)O)c4)cc3OCC(=O)O)c(O)c2c1 |
| InChI | InChI=1S/C32H27N7O11S2/c1-17-10-26(28(50-16-30(40)41)15-25(17)37-34-20-4-3-5-22(13-20)51(43,44)45)38-39-31-29(52(46,47)48)11-18-6-8-21(14-23(18)32(31)42)35-36-24-9-7-19(33)12-27(24)49-2/h3-15,42H,16,33H2,1-2H3,(H,40,41)(H,43,44,45)(H,46,47,48)/b36-35+,37-34+,39-38+ |
| InChIKey | CERCWALOEGNXGF-RQSNUSLKSA-N |
| XLogP | 7.65 |
| TPSA | 284.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.74 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|