C26H24N4O17S5 — CID 136600445
8-hydroxy-7-[[2-methoxy-5-methyl-4-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid (PubChem CID 136600445) has the molecular formula C26H24N4O17S5 and a molecular weight of 824.82 g/mol. Its IUPAC name is 8-hydroxy-7-[[2-methoxy-5-methyl-4-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid.
| Compound Name | 8-hydroxy-7-[[2-methoxy-5-methyl-4-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 136600445 |
| Molecular Formula | C26H24N4O17S5 |
| Molecular Weight | 824.82 g/mol |
| Exact Mass | 823.97 |
| IUPAC Name | 8-hydroxy-7-[[2-methoxy-5-methyl-4-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid |
| SMILES | COc1cc(/N=N/c2cccc(S(=O)(=O)CCOS(=O)(=O)O)c2)c(C)cc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2c1O |
| InChI | InChI=1S/C26H24N4O17S5/c1-14-8-20(21(46-2)13-19(14)28-27-16-4-3-5-17(11-16)48(32,33)7-6-47-52(43,44)45)29-30-25-23(51(40,41)42)10-15-9-18(49(34,35)36)12-22(50(37,38)39)24(15)26(25)31/h3-5,8-13,31H,6-7H2,1-2H3,(H,34,35,36)(H,37,38,39)(H,40,41,42)(H,43,44,45)/b28-27+,30-29+ |
| InChIKey | YZYLNQYASCMYCR-XOXGWFOHSA-N |
| XLogP | 4.03 |
| TPSA | 339.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|