C26H25N5O22S7 — CID 137274565
4-amino-5-hydroxy-3-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 137274565) has the molecular formula C26H25N5O22S7 and a molecular weight of 983.97 g/mol. Its IUPAC name is 4-amino-5-hydroxy-3-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-5-hydroxy-3-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 137274565 |
| Molecular Formula | C26H25N5O22S7 |
| Molecular Weight | 983.97 g/mol |
| Exact Mass | 982.90 |
| IUPAC Name | 4-amino-5-hydroxy-3-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[[2-sulfo-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2cccc(S(=O)(=O)CCOS(=O)(=O)O)c2)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(S(=O)(=O)CCOS(=O)(=O)O)cc3S(=O)(=O)O)c(O)c12 |
| InChI | InChI=1S/C26H25N5O22S7/c27-23-22-14(10-20(57(40,41)42)24(23)30-28-15-2-1-3-16(12-15)54(33,34)8-6-52-59(46,47)48)11-21(58(43,44)45)25(26(22)32)31-29-18-5-4-17(13-19(18)56(37,38)39)55(35,36)9-7-53-60(49,50)51/h1-5,10-13,32H,6-9,27H2,(H,37,38,39)(H,40,41,42)(H,43,44,45)(H,46,47,48)(H,49,50,51)/b30-28+,31-29+ |
| InChIKey | WFYRHEXADZEBQU-FUEWEDNTSA-N |
| XLogP | 1.88 |
| TPSA | 454.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.97 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|