C28H23N5O18S5 — CID 3034865
5-amino-4-hydroxy-3-[[5-hydroxy-6-[[2-hydroxy-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-sulfonaphthalen-2-yl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 3034865) has the molecular formula C28H23N5O18S5 and a molecular weight of 877.84 g/mol. Its IUPAC name is 5-amino-4-hydroxy-3-[[5-hydroxy-6-[[2-hydroxy-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-sulfonaphthalen-2-yl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-4-hydroxy-3-[[5-hydroxy-6-[[2-hydroxy-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-sulfonaphthalen-2-yl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 3034865 |
| Molecular Formula | C28H23N5O18S5 |
| Molecular Weight | 877.84 g/mol |
| Exact Mass | 876.96 |
| IUPAC Name | 5-amino-4-hydroxy-3-[[5-hydroxy-6-[[2-hydroxy-4-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-sulfonaphthalen-2-yl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc4c(O)c(/N=N/c5ccc(S(=O)(=O)CCOS(=O)(=O)O)cc5O)c(S(=O)(=O)O)cc4c3)c(O)c12 |
| InChI | InChI=1S/C28H23N5O18S5/c29-19-11-17(53(39,40)41)8-14-10-23(55(45,46)47)26(28(36)24(14)19)32-30-15-1-3-18-13(7-15)9-22(54(42,43)44)25(27(18)35)33-31-20-4-2-16(12-21(20)34)52(37,38)6-5-51-56(48,49)50/h1-4,7-12,34-36H,5-6,29H2,(H,39,40,41)(H,42,43,44)(H,45,46,47)(H,48,49,50)/b32-30+,33-31+ |
| InChIKey | PJNNTQNHAPWIMY-RRPBDJRISA-N |
| XLogP | 3.86 |
| TPSA | 397.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.84 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|