C27H27N5O20S6 — CID 137129777
5-amino-4-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 137129777) has the molecular formula C27H27N5O20S6 and a molecular weight of 933.93 g/mol. Its IUPAC name is 5-amino-4-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-amino-4-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 137129777 |
| Molecular Formula | C27H27N5O20S6 |
| Molecular Weight | 933.93 g/mol |
| Exact Mass | 932.96 |
| IUPAC Name | 5-amino-4-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-6-[[3-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | COc1ccc(S(=O)(=O)CCOS(=O)(=O)O)cc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3cccc(S(=O)(=O)CCOS(=O)(=O)O)c3)c(N)c2c1O |
| InChI | InChI=1S/C27H27N5O20S6/c1-50-20-6-5-18(54(36,37)10-8-52-58(47,48)49)14-19(20)30-32-26-22(56(41,42)43)12-15-11-21(55(38,39)40)25(24(28)23(15)27(26)33)31-29-16-3-2-4-17(13-16)53(34,35)9-7-51-57(44,45)46/h2-6,11-14,33H,7-10,28H2,1H3,(H,38,39,40)(H,41,42,43)(H,44,45,46)(H,47,48,49)/b31-29+,32-30+ |
| InChIKey | HSRLTSYQCIIUGH-JWTBXLROSA-N |
| XLogP | 2.65 |
| TPSA | 409.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.93 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|