C22H27N3O11S3 — CID 158635020
4-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-methyl-5-(methylamino)naphthalene-2-sulfonic acid;methane (PubChem CID 158635020) has the molecular formula C22H27N3O11S3 and a molecular weight of 605.67 g/mol. Its IUPAC name is 4-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-methyl-5-(methylamino)naphthalene-2-sulfonic acid;methane.
| Compound Name | 4-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-methyl-5-(methylamino)naphthalene-2-sulfonic acid;methane |
|---|---|
| PubChem CID | 158635020 |
| Molecular Formula | C22H27N3O11S3 |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.08 |
| IUPAC Name | 4-hydroxy-3-[[2-methoxy-5-(2-sulfooxyethylsulfonyl)phenyl]diazenyl]-7-methyl-5-(methylamino)naphthalene-2-sulfonic acid;methane |
| SMILES | C.CNc1cc(C)cc2cc(S(=O)(=O)O)c(/N=N/c3cc(S(=O)(=O)CCOS(=O)(=O)O)ccc3OC)c(O)c12 |
| InChI | InChI=1S/C21H23N3O11S3.CH4/c1-12-8-13-10-18(37(28,29)30)20(21(25)19(13)16(9-12)22-2)24-23-15-11-14(4-5-17(15)34-3)36(26,27)7-6-35-38(31,32)33;/h4-5,8-11,22,25H,6-7H2,1-3H3,(H,28,29,30)(H,31,32,33);1H4/b24-23+; |
| InChIKey | HZQXYGBRBCFMSA-XMXXDQCKSA-N |
| XLogP | 3.80 |
| TPSA | 218.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|