C18H16N2Na2O8S2 — CID 137179802
CID 137179802 (PubChem CID 137179802) has the molecular formula C18H16N2Na2O8S2 and a molecular weight of 498.45 g/mol.
| Compound Name | CID 137179802 |
|---|---|
| PubChem CID | 137179802 |
| Molecular Formula | C18H16N2Na2O8S2 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | — |
| SMILES | COc1ccc(C)cc1/N=N/c1c(S(=O)(=O)O)cc2cccc(S(=O)(=O)O)c2c1O.[Na].[Na] |
| InChI | InChI=1S/C18H16N2O8S2.2Na/c1-10-6-7-13(28-2)12(8-10)19-20-17-15(30(25,26)27)9-11-4-3-5-14(29(22,23)24)16(11)18(17)21;;/h3-9,21H,1-2H3,(H,22,23,24)(H,25,26,27);;/b20-19+;; |
| InChIKey | VMHFXXOWFBDPDT-LLIZZRELSA-N |
| XLogP | 3.01 |
| TPSA | 162.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|