C23H19N5O7S2 — CID 137095404
5-amino-4-hydroxy-3-[(3-methylphenyl)diazenyl]-6-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 137095404) has the molecular formula C23H19N5O7S2 and a molecular weight of 541.57 g/mol. Its IUPAC name is 5-amino-4-hydroxy-3-[(3-methylphenyl)diazenyl]-6-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-amino-4-hydroxy-3-[(3-methylphenyl)diazenyl]-6-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137095404 |
| Molecular Formula | C23H19N5O7S2 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | 5-amino-4-hydroxy-3-[(3-methylphenyl)diazenyl]-6-[(2-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1cccc(/N=N/c2c(S(=O)(=O)O)cc3ccc(/N=N/c4ccccc4S(=O)(=O)O)c(N)c3c2O)c1 |
| InChI | InChI=1S/C23H19N5O7S2/c1-13-5-4-6-15(11-13)25-28-22-19(37(33,34)35)12-14-9-10-17(21(24)20(14)23(22)29)27-26-16-7-2-3-8-18(16)36(30,31)32/h2-12,29H,24H2,1H3,(H,30,31,32)(H,33,34,35)/b27-26+,28-25+ |
| InChIKey | SSYDMSLAIIXWKC-JOSXGXAISA-N |
| XLogP | 5.76 |
| TPSA | 204.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|