C22H16N6O6S — CID 136634817
5-amino-4-hydroxy-6-[(4-nitrophenyl)diazenyl]-3-phenyldiazenylnaphthalene-2-sulfonic acid (PubChem CID 136634817) has the molecular formula C22H16N6O6S and a molecular weight of 492.47 g/mol. Its IUPAC name is 5-amino-4-hydroxy-6-[(4-nitrophenyl)diazenyl]-3-phenyldiazenylnaphthalene-2-sulfonic acid.
| Compound Name | 5-amino-4-hydroxy-6-[(4-nitrophenyl)diazenyl]-3-phenyldiazenylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136634817 |
| Molecular Formula | C22H16N6O6S |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 5-amino-4-hydroxy-6-[(4-nitrophenyl)diazenyl]-3-phenyldiazenylnaphthalene-2-sulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc([N+](=O)[O-])cc2)ccc2cc(S(=O)(=O)O)c(/N=N/c3ccccc3)c(O)c12 |
| InChI | InChI=1S/C22H16N6O6S/c23-20-17(26-24-15-7-9-16(10-8-15)28(30)31)11-6-13-12-18(35(32,33)34)21(22(29)19(13)20)27-25-14-4-2-1-3-5-14/h1-12,29H,23H2,(H,32,33,34)/b26-24+,27-25+ |
| InChIKey | NLVMVAXXVLJMHC-OWUYFMIJSA-N |
| XLogP | 6.11 |
| TPSA | 193.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|