C23H18N6NaO10S2+ — CID 135422237
sodium 5-amino-4-hydroxy-3-[(2-methoxyphenyl)diazenyl]-6-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 135422237) has the molecular formula C23H18N6NaO10S2+ and a molecular weight of 625.55 g/mol. Its IUPAC name is sodium 5-amino-4-hydroxy-3-[(2-methoxyphenyl)diazenyl]-6-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | sodium 5-amino-4-hydroxy-3-[(2-methoxyphenyl)diazenyl]-6-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135422237 |
| Molecular Formula | C23H18N6NaO10S2+ |
| Molecular Weight | 625.55 g/mol |
| Exact Mass | 625.04 |
| IUPAC Name | sodium 5-amino-4-hydroxy-3-[(2-methoxyphenyl)diazenyl]-6-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | COc1ccccc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc([N+](=O)[O-])cc3)c(N)c2c1O.[Na+] |
| InChI | InChI=1S/C23H18N6O10S2.Na/c1-39-16-5-3-2-4-15(16)26-28-22-18(41(36,37)38)11-12-10-17(40(33,34)35)21(20(24)19(12)23(22)30)27-25-13-6-8-14(9-7-13)29(31)32;/h2-11,30H,24H2,1H3,(H,33,34,35)(H,36,37,38);/q;+1/b27-25+,28-26+; |
| InChIKey | AVQZMCOMHXWHHE-GKSBCSGRSA-N |
| XLogP | 2.37 |
| TPSA | 256.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|