C22H13N7Na2O11S2 — CID 135666467
disodium;4-amino-5-hydroxy-3,6-bis[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonate (PubChem CID 135666467) has the molecular formula C22H13N7Na2O11S2 and a molecular weight of 661.50 g/mol. Its IUPAC name is disodium;4-amino-5-hydroxy-3,6-bis[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonate.
| Compound Name | disodium;4-amino-5-hydroxy-3,6-bis[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 135666467 |
| Molecular Formula | C22H13N7Na2O11S2 |
| Molecular Weight | 661.50 g/mol |
| Exact Mass | 660.99 |
| IUPAC Name | disodium;4-amino-5-hydroxy-3,6-bis[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonate |
| SMILES | Nc1c(/N=N/c2ccc([N+](=O)[O-])cc2)c(S(=O)(=O)[O-])cc2cc(S(=O)(=O)[O-])c(/N=N/c3ccc([N+](=O)[O-])cc3)c(O)c12.[Na+].[Na+] |
| InChI | InChI=1S/C22H15N7O11S2.2Na/c23-19-18-11(9-16(41(35,36)37)20(19)26-24-12-1-5-14(6-2-12)28(31)32)10-17(42(38,39)40)21(22(18)30)27-25-13-3-7-15(8-4-13)29(33)34;;/h1-10,30H,23H2,(H,35,36,37)(H,38,39,40);;/q;2*+1/p-2/b26-24+,27-25+;; |
| InChIKey | NAWOGWWONGONIF-SRJQXOPESA-L |
| XLogP | -1.41 |
| TPSA | 296.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.50 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|