C34H24N8Na2O10S2 — CID 137242219
CID 137242219 (PubChem CID 137242219) has the molecular formula C34H24N8Na2O10S2 and a molecular weight of 814.73 g/mol.
| Compound Name | CID 137242219 |
|---|---|
| PubChem CID | 137242219 |
| Molecular Formula | C34H24N8Na2O10S2 |
| Molecular Weight | 814.73 g/mol |
| Exact Mass | 814.09 |
| IUPAC Name | — |
| SMILES | Nc1c(/N=N/c2ccc([N+](=O)[O-])cc2)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(-c4ccc(/N=N/c5ccc(O)cc5)cc4)cc3)c(O)c12.[Na].[Na] |
| InChI | InChI=1S/C34H24N8O10S2.2Na/c35-31-30-21(17-28(53(47,48)49)32(31)40-38-24-9-13-26(14-10-24)42(45)46)18-29(54(50,51)52)33(34(30)44)41-39-23-7-3-20(4-8-23)19-1-5-22(6-2-19)36-37-25-11-15-27(43)16-12-25;;/h1-18,43-44H,35H2,(H,47,48,49)(H,50,51,52);;/b37-36+,40-38+,41-39+;; |
| InChIKey | ZBZNKKZLZBXKBC-NQJWOQTRSA-N |
| XLogP | 8.39 |
| TPSA | 292.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.73 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|