C35H24N8O12S2 — CID 135968934
2-[[4-[4-[[8-amino-1-hydroxy-7-[(4-nitrophenyl)diazenyl]-3,6-disulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]-5-hydroxybenzoic acid (PubChem CID 135968934) has the molecular formula C35H24N8O12S2 and a molecular weight of 812.76 g/mol. Its IUPAC name is 2-[[4-[4-[[8-amino-1-hydroxy-7-[(4-nitrophenyl)diazenyl]-3,6-disulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]-5-hydroxybenzoic acid.
| Compound Name | 2-[[4-[4-[[8-amino-1-hydroxy-7-[(4-nitrophenyl)diazenyl]-3,6-disulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 135968934 |
| Molecular Formula | C35H24N8O12S2 |
| Molecular Weight | 812.76 g/mol |
| Exact Mass | 812.10 |
| IUPAC Name | 2-[[4-[4-[[8-amino-1-hydroxy-7-[(4-nitrophenyl)diazenyl]-3,6-disulfonaphthalen-2-yl]diazenyl]phenyl]phenyl]diazenyl]-5-hydroxybenzoic acid |
| SMILES | Nc1c(/N=N/c2ccc([N+](=O)[O-])cc2)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc(-c4ccc(/N=N/c5ccc(O)cc5C(=O)O)cc4)cc3)c(O)c12 |
| InChI | InChI=1S/C35H24N8O12S2/c36-31-30-20(15-28(56(50,51)52)32(31)41-38-23-9-11-24(12-10-23)43(48)49)16-29(57(53,54)55)33(34(30)45)42-39-22-7-3-19(4-8-22)18-1-5-21(6-2-18)37-40-27-14-13-25(44)17-26(27)35(46)47/h1-17,44-45H,36H2,(H,46,47)(H,50,51,52)(H,53,54,55)/b40-37+,41-38+,42-39+ |
| InChIKey | SLEFEVNMCGIYOQ-FHJKABMISA-N |
| XLogP | 8.85 |
| TPSA | 329.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.76 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|