C36H31N9Na2O9S2 — CID 170844336
CID 170844336 (PubChem CID 170844336) has the molecular formula C36H31N9Na2O9S2 and a molecular weight of 843.81 g/mol.
| Compound Name | CID 170844336 |
|---|---|
| PubChem CID | 170844336 |
| Molecular Formula | C36H31N9Na2O9S2 |
| Molecular Weight | 843.81 g/mol |
| Exact Mass | 843.15 |
| IUPAC Name | — |
| SMILES | COc1cc(-c2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)c(/N=N/c5ccccc5)c(O)c4c3N)c(OC)c2)ccc1/N=N/c1ccc(N)cc1N.[Na].[Na] |
| InChI | InChI=1S/C36H31N9O9S2.2Na/c1-53-28-14-19(8-11-26(28)42-41-25-13-10-22(37)18-24(25)38)20-9-12-27(29(15-20)54-2)43-44-34-30(55(47,48)49)16-21-17-31(56(50,51)52)35(36(46)32(21)33(34)39)45-40-23-6-4-3-5-7-23;;/h3-18,46H,37-39H2,1-2H3,(H,47,48,49)(H,50,51,52);;/b42-41+,44-43+,45-40+;; |
| InChIKey | BAUICRTZTUACAD-LTMBCSMWSA-N |
| XLogP | 7.95 |
| TPSA | 299.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.81 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|