C42H43N9O9S2 — CID 136734413
4-amino-3-[[2-butoxy-4-[3-butoxy-4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid (PubChem CID 136734413) has the molecular formula C42H43N9O9S2 and a molecular weight of 881.99 g/mol. Its IUPAC name is 4-amino-3-[[2-butoxy-4-[3-butoxy-4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3-[[2-butoxy-4-[3-butoxy-4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136734413 |
| Molecular Formula | C42H43N9O9S2 |
| Molecular Weight | 881.99 g/mol |
| Exact Mass | 881.26 |
| IUPAC Name | 4-amino-3-[[2-butoxy-4-[3-butoxy-4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-2,7-disulfonic acid |
| SMILES | CCCCOc1cc(-c2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(S(=O)(=O)O)c(/N=N/c5ccccc5)c(O)c4c3N)c(OCCCC)c2)ccc1/N=N/c1ccc(N)cc1N |
| InChI | InChI=1S/C42H43N9O9S2/c1-3-5-18-59-34-20-25(12-15-32(34)48-47-31-17-14-28(43)24-30(31)44)26-13-16-33(35(21-26)60-19-6-4-2)49-50-40-36(61(53,54)55)22-27-23-37(62(56,57)58)41(42(52)38(27)39(40)45)51-46-29-10-8-7-9-11-29/h7-17,20-24,52H,3-6,18-19,43-45H2,1-2H3,(H,53,54,55)(H,56,57,58)/b48-47+,50-49+,51-46+ |
| InChIKey | SQIMMLCEAVCIBW-XSROXMEDSA-N |
| XLogP | 11.06 |
| TPSA | 299.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.99 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|