C28H23N7O7S2 — CID 136714800
4-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 136714800) has the molecular formula C28H23N7O7S2 and a molecular weight of 633.67 g/mol. Its IUPAC name is 4-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136714800 |
| Molecular Formula | C28H23N7O7S2 |
| Molecular Weight | 633.67 g/mol |
| Exact Mass | 633.11 |
| IUPAC Name | 4-amino-3-[[4-[4-[(2,4-diaminophenyl)diazenyl]phenyl]phenyl]diazenyl]-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc(/N=N/c2ccc(-c3ccc(/N=N/c4c(S(=O)(=O)O)cc5cc(S(=O)(=O)O)cc(O)c5c4N)cc3)cc2)c(N)c1 |
| InChI | InChI=1S/C28H23N7O7S2/c29-18-5-10-23(22(30)13-18)34-32-19-6-1-15(2-7-19)16-3-8-20(9-4-16)33-35-28-25(44(40,41)42)12-17-11-21(43(37,38)39)14-24(36)26(17)27(28)31/h1-14,36H,29-31H2,(H,37,38,39)(H,40,41,42)/b34-32+,35-33+ |
| InChIKey | GCNIJCDLBAEWSZ-XUXOKTBYSA-N |
| XLogP | 6.28 |
| TPSA | 256.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|