C25H22N5O5S- — CID 135920985
6-amino-4-hydroxy-3-[(4-phenyldiazenyl-2-propoxyphenyl)diazenyl]naphthalene-2-sulfonate (PubChem CID 135920985) has the molecular formula C25H22N5O5S- and a molecular weight of 504.55 g/mol. Its IUPAC name is 6-amino-4-hydroxy-3-[(4-phenyldiazenyl-2-propoxyphenyl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | 6-amino-4-hydroxy-3-[(4-phenyldiazenyl-2-propoxyphenyl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135920985 |
| Molecular Formula | C25H22N5O5S- |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 6-amino-4-hydroxy-3-[(4-phenyldiazenyl-2-propoxyphenyl)diazenyl]naphthalene-2-sulfonate |
| SMILES | CCCOc1cc(/N=N/c2ccccc2)ccc1/N=N/c1c(S(=O)(=O)[O-])cc2ccc(N)cc2c1O |
| InChI | InChI=1S/C25H23N5O5S/c1-2-12-35-22-15-19(28-27-18-6-4-3-5-7-18)10-11-21(22)29-30-24-23(36(32,33)34)13-16-8-9-17(26)14-20(16)25(24)31/h3-11,13-15,31H,2,12,26H2,1H3,(H,32,33,34)/p-1/b28-27+,30-29+ |
| InChIKey | DPOVPFFSXNZGFR-XOXGWFOHSA-M |
| XLogP | 6.65 |
| TPSA | 162.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|