C20H13N3Na2O8S2 — CID 165363630
disodium;6-amino-4-hydroxy-3-[(8-hydroxy-6-sulfonatonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonate (PubChem CID 165363630) has the molecular formula C20H13N3Na2O8S2 and a molecular weight of 533.45 g/mol. Its IUPAC name is disodium;6-amino-4-hydroxy-3-[(8-hydroxy-6-sulfonatonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | disodium;6-amino-4-hydroxy-3-[(8-hydroxy-6-sulfonatonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 165363630 |
| Molecular Formula | C20H13N3Na2O8S2 |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 532.99 |
| IUPAC Name | disodium;6-amino-4-hydroxy-3-[(8-hydroxy-6-sulfonatonaphthalen-2-yl)diazenyl]naphthalene-2-sulfonate |
| SMILES | Nc1ccc2cc(S(=O)(=O)[O-])c(/N=N/c3ccc4cc(S(=O)(=O)[O-])cc(O)c4c3)c(O)c2c1.[Na+].[Na+] |
| InChI | InChI=1S/C20H15N3O8S2.2Na/c21-12-3-1-11-6-18(33(29,30)31)19(20(25)16(11)7-12)23-22-13-4-2-10-5-14(32(26,27)28)9-17(24)15(10)8-13;;/h1-9,24-25H,21H2,(H,26,27,28)(H,29,30,31);;/q;2*+1/p-2/b23-22+;; |
| InChIKey | WBPPYFXPUKOADG-VPMNAVQSSA-L |
| XLogP | -2.78 |
| TPSA | 205.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|