C16H12N3NaO4S — CID 135570888
sodium 7-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2-sulfonate (PubChem CID 135570888) has the molecular formula C16H12N3NaO4S and a molecular weight of 365.35 g/mol. Its IUPAC name is sodium 7-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2-sulfonate.
| Compound Name | sodium 7-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135570888 |
| Molecular Formula | C16H12N3NaO4S |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | sodium 7-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2-sulfonate |
| SMILES | Nc1ccc2c(O)c(/N=N/c3ccccc3)c(S(=O)(=O)[O-])cc2c1.[Na+] |
| InChI | InChI=1S/C16H13N3O4S.Na/c17-11-6-7-13-10(8-11)9-14(24(21,22)23)15(16(13)20)19-18-12-4-2-1-3-5-12;/h1-9,20H,17H2,(H,21,22,23);/q;+1/p-1/b19-18+; |
| InChIKey | UKQPYKBHTGBUBC-LTRPLHCISA-M |
| XLogP | 0.45 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|