C23H18N5NaO5S — CID 135666524
sodium 6-amino-4-hydroxy-3-[(2-methoxy-4-phenyldiazenylphenyl)diazenyl]naphthalene-2-sulfonate (PubChem CID 135666524) has the molecular formula C23H18N5NaO5S and a molecular weight of 499.48 g/mol. Its IUPAC name is sodium 6-amino-4-hydroxy-3-[(2-methoxy-4-phenyldiazenylphenyl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | sodium 6-amino-4-hydroxy-3-[(2-methoxy-4-phenyldiazenylphenyl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135666524 |
| Molecular Formula | C23H18N5NaO5S |
| Molecular Weight | 499.48 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | sodium 6-amino-4-hydroxy-3-[(2-methoxy-4-phenyldiazenylphenyl)diazenyl]naphthalene-2-sulfonate |
| SMILES | COc1cc(/N=N/c2ccccc2)ccc1/N=N/c1c(S(=O)(=O)[O-])cc2ccc(N)cc2c1O.[Na+] |
| InChI | InChI=1S/C23H19N5O5S.Na/c1-33-20-13-17(26-25-16-5-3-2-4-6-16)9-10-19(20)27-28-22-21(34(30,31)32)11-14-7-8-15(24)12-18(14)23(22)29;/h2-13,29H,24H2,1H3,(H,30,31,32);/q;+1/p-1/b26-25+,28-27+; |
| InChIKey | MLMLPDAUPBFSNG-UFVBRFPFSA-M |
| XLogP | 2.88 |
| TPSA | 162.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|