C37H31N9O5S — CID 136606721
3-amino-5-hydroxy-6-[[4-[[4-[(2-methoxy-4-phenyldiazenylphenyl)diazenyl]-3-methylphenyl]diazenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136606721) has the molecular formula C37H31N9O5S and a molecular weight of 713.78 g/mol. Its IUPAC name is 3-amino-5-hydroxy-6-[[4-[[4-[(2-methoxy-4-phenyldiazenylphenyl)diazenyl]-3-methylphenyl]diazenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 3-amino-5-hydroxy-6-[[4-[[4-[(2-methoxy-4-phenyldiazenylphenyl)diazenyl]-3-methylphenyl]diazenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136606721 |
| Molecular Formula | C37H31N9O5S |
| Molecular Weight | 713.78 g/mol |
| Exact Mass | 713.22 |
| IUPAC Name | 3-amino-5-hydroxy-6-[[4-[[4-[(2-methoxy-4-phenyldiazenylphenyl)diazenyl]-3-methylphenyl]diazenyl]-3-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2ccccc2)ccc1/N=N/c1ccc(/N=N/c2ccc(/N=N/c3ccc4cc(S(=O)(=O)O)c(N)cc4c3O)cc2C)cc1C |
| InChI | InChI=1S/C37H31N9O5S/c1-22-17-27(42-46-34-13-9-24-19-36(52(48,49)50)30(38)21-29(24)37(34)47)10-14-31(22)43-41-26-11-15-32(23(2)18-26)44-45-33-16-12-28(20-35(33)51-3)40-39-25-7-5-4-6-8-25/h4-21,47H,38H2,1-3H3,(H,48,49,50)/b40-39+,43-41+,45-44+,46-42+ |
| InChIKey | JECCPJCZHVOBQY-CTFMQLSHSA-N |
| XLogP | 11.66 |
| TPSA | 208.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.78 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|