C28H22N6O4S — CID 140963076
2-amino-5-[[5-hydroxy-6-[(4-phenyldiazenylphenyl)diazenyl]naphthalen-2-yl]amino]benzenesulfonic acid (PubChem CID 140963076) has the molecular formula C28H22N6O4S and a molecular weight of 538.59 g/mol. Its IUPAC name is 2-amino-5-[[5-hydroxy-6-[(4-phenyldiazenylphenyl)diazenyl]naphthalen-2-yl]amino]benzenesulfonic acid.
| Compound Name | 2-amino-5-[[5-hydroxy-6-[(4-phenyldiazenylphenyl)diazenyl]naphthalen-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 140963076 |
| Molecular Formula | C28H22N6O4S |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 2-amino-5-[[5-hydroxy-6-[(4-phenyldiazenylphenyl)diazenyl]naphthalen-2-yl]amino]benzenesulfonic acid |
| SMILES | Nc1ccc(Nc2ccc3c(O)c(/N=N/c4ccc(/N=N/c5ccccc5)cc4)ccc3c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C28H22N6O4S/c29-25-14-12-23(17-27(25)39(36,37)38)30-22-11-13-24-18(16-22)6-15-26(28(24)35)34-33-21-9-7-20(8-10-21)32-31-19-4-2-1-3-5-19/h1-17,30,35H,29H2,(H,36,37,38)/b32-31+,34-33+ |
| InChIKey | TWLUHNHHTMHOLG-HSBKYFPUSA-N |
| XLogP | 7.95 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|