C22H18N4O4S — CID 136917514
3-[(4-aminophenyl)diazenyl]-6-anilino-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136917514) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 3-[(4-aminophenyl)diazenyl]-6-anilino-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 3-[(4-aminophenyl)diazenyl]-6-anilino-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136917514 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 3-[(4-aminophenyl)diazenyl]-6-anilino-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2c(S(=O)(=O)O)cc3ccc(Nc4ccccc4)cc3c2O)cc1 |
| InChI | InChI=1S/C22H18N4O4S/c23-15-7-10-17(11-8-15)25-26-21-20(31(28,29)30)12-14-6-9-18(13-19(14)22(21)27)24-16-4-2-1-3-5-16/h1-13,24,27H,23H2,(H,28,29,30)/b26-25+ |
| InChIKey | OJMNZCGRPKQWDT-OCEACIFDSA-N |
| XLogP | 5.53 |
| TPSA | 137.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|