C44H32N6O10S2 — CID 136703371
7-anilino-3-[[4-[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-hydroxyphenyl]-2-hydroxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136703371) has the molecular formula C44H32N6O10S2 and a molecular weight of 868.91 g/mol. Its IUPAC name is 7-anilino-3-[[4-[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-hydroxyphenyl]-2-hydroxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-anilino-3-[[4-[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-hydroxyphenyl]-2-hydroxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136703371 |
| Molecular Formula | C44H32N6O10S2 |
| Molecular Weight | 868.91 g/mol |
| Exact Mass | 868.16 |
| IUPAC Name | 7-anilino-3-[[4-[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-3-hydroxyphenyl]-2-hydroxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc2cc(Nc3ccccc3)ccc2c(O)c1/N=N/c1ccc(-c2ccc(/N=N/c3c(S(=O)(=O)O)cc4cc(Nc5ccccc5)ccc4c3O)c(O)c2)cc1O |
| InChI | InChI=1S/C44H32N6O10S2/c51-37-21-25(11-17-35(37)47-49-41-39(61(55,56)57)23-27-19-31(13-15-33(27)43(41)53)45-29-7-3-1-4-8-29)26-12-18-36(38(52)22-26)48-50-42-40(62(58,59)60)24-28-20-32(14-16-34(28)44(42)54)46-30-9-5-2-6-10-30/h1-24,45-46,51-54H,(H,55,56,57)(H,58,59,60)/b49-47+,50-48+ |
| InChIKey | ACENHAQXKHSAQX-RYZURTRPSA-N |
| XLogP | 11.29 |
| TPSA | 263.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.91 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|