C30H25N5O10S2 — CID 137280015
7-anilino-4-hydroxy-3-[[2-hydroxy-5-methoxy-4-[(4-methoxy-2-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 137280015) has the molecular formula C30H25N5O10S2 and a molecular weight of 679.69 g/mol. Its IUPAC name is 7-anilino-4-hydroxy-3-[[2-hydroxy-5-methoxy-4-[(4-methoxy-2-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-anilino-4-hydroxy-3-[[2-hydroxy-5-methoxy-4-[(4-methoxy-2-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137280015 |
| Molecular Formula | C30H25N5O10S2 |
| Molecular Weight | 679.69 g/mol |
| Exact Mass | 679.10 |
| IUPAC Name | 7-anilino-4-hydroxy-3-[[2-hydroxy-5-methoxy-4-[(4-methoxy-2-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1ccc(/N=N/c2cc(O)c(/N=N/c3c(S(=O)(=O)O)cc4cc(Nc5ccccc5)ccc4c3O)cc2OC)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C30H25N5O10S2/c1-44-20-9-11-22(27(14-20)46(38,39)40)32-34-24-15-25(36)23(16-26(24)45-2)33-35-29-28(47(41,42)43)13-17-12-19(8-10-21(17)30(29)37)31-18-6-4-3-5-7-18/h3-16,31,36-37H,1-2H3,(H,38,39,40)(H,41,42,43)/b34-32+,35-33+ |
| InChIKey | QMACYHUWWJHRCK-XUXOKTBYSA-N |
| XLogP | 7.34 |
| TPSA | 229.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.69 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|