C34H27N5O12S3 — CID 137142815
3-[[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 137142815) has the molecular formula C34H27N5O12S3 and a molecular weight of 793.81 g/mol. Its IUPAC name is 3-[[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 137142815 |
| Molecular Formula | C34H27N5O12S3 |
| Molecular Weight | 793.81 g/mol |
| Exact Mass | 793.08 |
| IUPAC Name | 3-[[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | COc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(Nc4ccccc4)ccc3c2O)c(OC)cc1/N=N/c1cc(S(=O)(=O)O)c2cccc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C34H27N5O12S3/c1-50-28-18-27(38-39-33-32(54(47,48)49)14-19-13-21(11-12-23(19)34(33)40)35-20-7-4-3-5-8-20)29(51-2)17-26(28)37-36-22-15-25-24(31(16-22)53(44,45)46)9-6-10-30(25)52(41,42)43/h3-18,35,40H,1-2H3,(H,41,42,43)(H,44,45,46)(H,47,48,49)/b37-36+,39-38+ |
| InChIKey | QAPLBNSGHVRTRM-DVQJGIKISA-N |
| XLogP | 8.03 |
| TPSA | 263.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.81 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|