C33H25N5O12S3 — CID 137280006
7-[[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-hydroxy-2-methoxyphenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 137280006) has the molecular formula C33H25N5O12S3 and a molecular weight of 779.79 g/mol. Its IUPAC name is 7-[[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-hydroxy-2-methoxyphenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-hydroxy-2-methoxyphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 137280006 |
| Molecular Formula | C33H25N5O12S3 |
| Molecular Weight | 779.79 g/mol |
| Exact Mass | 779.07 |
| IUPAC Name | 7-[[4-[(6-anilino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]-5-hydroxy-2-methoxyphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | COc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(Nc4ccccc4)ccc3c2O)c(O)cc1/N=N/c1ccc2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C33H25N5O12S3/c1-50-29-17-26(28(39)16-27(29)37-35-22-8-7-18-12-23(51(41,42)43)15-30(25(18)14-22)52(44,45)46)36-38-32-31(53(47,48)49)13-19-11-21(9-10-24(19)33(32)40)34-20-5-3-2-4-6-20/h2-17,34,39-40H,1H3,(H,41,42,43)(H,44,45,46)(H,47,48,49)/b37-35+,38-36+ |
| InChIKey | MMRBBQHJWCGOLR-ATXIYDNESA-N |
| XLogP | 7.73 |
| TPSA | 274.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.79 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|