C31H28N6O8S2 — CID 137126017
7-anilino-3-[[2,5-dimethoxy-4-[[4-(methylsulfamoyl)phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 137126017) has the molecular formula C31H28N6O8S2 and a molecular weight of 676.73 g/mol. Its IUPAC name is 7-anilino-3-[[2,5-dimethoxy-4-[[4-(methylsulfamoyl)phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-anilino-3-[[2,5-dimethoxy-4-[[4-(methylsulfamoyl)phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137126017 |
| Molecular Formula | C31H28N6O8S2 |
| Molecular Weight | 676.73 g/mol |
| Exact Mass | 676.14 |
| IUPAC Name | 7-anilino-3-[[2,5-dimethoxy-4-[[4-(methylsulfamoyl)phenyl]diazenyl]phenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CNS(=O)(=O)c1ccc(/N=N/c2cc(OC)c(/N=N/c3c(S(=O)(=O)O)cc4cc(Nc5ccccc5)ccc4c3O)cc2OC)cc1 |
| InChI | InChI=1S/C31H28N6O8S2/c1-32-46(39,40)23-12-9-21(10-13-23)34-35-25-17-28(45-3)26(18-27(25)44-2)36-37-30-29(47(41,42)43)16-19-15-22(11-14-24(19)31(30)38)33-20-7-5-4-6-8-20/h4-18,32-33,38H,1-3H3,(H,41,42,43)/b35-34+,37-36+ |
| InChIKey | UEXKXBDMNXNERH-XGMUGIETSA-N |
| XLogP | 7.29 |
| TPSA | 200.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.73 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|