C37H40N6O10S2 — CID 137302216
7-anilino-4-hydroxy-3-[[4-[[4-[3-[2-(2-hydroxyethoxy)ethoxy]propylsulfamoyl]phenyl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]naphthalene-2-sulfonic acid (PubChem CID 137302216) has the molecular formula C37H40N6O10S2 and a molecular weight of 792.89 g/mol. Its IUPAC name is 7-anilino-4-hydroxy-3-[[4-[[4-[3-[2-(2-hydroxyethoxy)ethoxy]propylsulfamoyl]phenyl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-anilino-4-hydroxy-3-[[4-[[4-[3-[2-(2-hydroxyethoxy)ethoxy]propylsulfamoyl]phenyl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137302216 |
| Molecular Formula | C37H40N6O10S2 |
| Molecular Weight | 792.89 g/mol |
| Exact Mass | 792.22 |
| IUPAC Name | 7-anilino-4-hydroxy-3-[[4-[[4-[3-[2-(2-hydroxyethoxy)ethoxy]propylsulfamoyl]phenyl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(Nc4ccccc4)ccc3c2O)c(C)cc1/N=N/c1ccc(S(=O)(=O)NCCCOCCOCCO)cc1 |
| InChI | InChI=1S/C37H40N6O10S2/c1-25-21-33(42-40-28-9-12-30(13-10-28)54(46,47)38-15-6-17-52-19-20-53-18-16-44)34(51-2)24-32(25)41-43-36-35(55(48,49)50)23-26-22-29(11-14-31(26)37(36)45)39-27-7-4-3-5-8-27/h3-5,7-14,21-24,38-39,44-45H,6,15-20H2,1-2H3,(H,48,49,50)/b42-40+,43-41+ |
| InChIKey | QWELAULGVLBNJW-IZRQRQPJSA-N |
| XLogP | 7.38 |
| TPSA | 230.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.89 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|