C39H35N7O11S2 — CID 137200907
7-anilino-3-[[4-[[2,5-dimethoxy-4-[(4-methyl-2-sulfophenyl)diazenyl]phenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 137200907) has the molecular formula C39H35N7O11S2 and a molecular weight of 841.88 g/mol. Its IUPAC name is 7-anilino-3-[[4-[[2,5-dimethoxy-4-[(4-methyl-2-sulfophenyl)diazenyl]phenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-anilino-3-[[4-[[2,5-dimethoxy-4-[(4-methyl-2-sulfophenyl)diazenyl]phenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 137200907 |
| Molecular Formula | C39H35N7O11S2 |
| Molecular Weight | 841.88 g/mol |
| Exact Mass | 841.18 |
| IUPAC Name | 7-anilino-3-[[4-[[2,5-dimethoxy-4-[(4-methyl-2-sulfophenyl)diazenyl]phenyl]diazenyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc(C)cc2S(=O)(=O)O)c(OC)cc1/N=N/c1cc(OC)c(/N=N/c2c(S(=O)(=O)O)cc3cc(Nc4ccccc4)ccc3c2O)cc1OC |
| InChI | InChI=1S/C39H35N7O11S2/c1-22-11-14-27(36(15-22)58(48,49)50)41-42-28-18-33(55-3)29(19-32(28)54-2)43-44-30-20-35(57-5)31(21-34(30)56-4)45-46-38-37(59(51,52)53)17-23-16-25(12-13-26(23)39(38)47)40-24-9-7-6-8-10-24/h6-21,40,47H,1-5H3,(H,48,49,50)(H,51,52,53)/b42-41+,44-43+,46-45+ |
| InChIKey | DYOWDJHUVPSKAI-NOGTXXKZSA-N |
| XLogP | 10.37 |
| TPSA | 252.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.88 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|