C32H29N5O8S2 — CID 157424812
7-anilino-3-[[4-[(4-ethylsulfonylphenyl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 157424812) has the molecular formula C32H29N5O8S2 and a molecular weight of 675.75 g/mol. Its IUPAC name is 7-anilino-3-[[4-[(4-ethylsulfonylphenyl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-anilino-3-[[4-[(4-ethylsulfonylphenyl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 157424812 |
| Molecular Formula | C32H29N5O8S2 |
| Molecular Weight | 675.75 g/mol |
| Exact Mass | 675.15 |
| IUPAC Name | 7-anilino-3-[[4-[(4-ethylsulfonylphenyl)diazenyl]-2,5-dimethoxyphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CCS(=O)(=O)c1ccc(/N=N/c2cc(OC)c(/N=N/c3c(S(=O)(=O)O)cc4cc(Nc5ccccc5)ccc4c3O)cc2OC)cc1 |
| InChI | InChI=1S/C32H29N5O8S2/c1-4-46(39,40)24-13-10-22(11-14-24)34-35-26-18-29(45-3)27(19-28(26)44-2)36-37-31-30(47(41,42)43)17-20-16-23(12-15-25(20)32(31)38)33-21-8-6-5-7-9-21/h5-19,33,38H,4H2,1-3H3,(H,41,42,43)/b35-34+,37-36+ |
| InChIKey | PTULXRKOIRFBKN-XGMUGIETSA-N |
| XLogP | 8.18 |
| TPSA | 188.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.75 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|