C38H33N7O5S — CID 136995279
7-anilino-3-[[4-[(2,5-dimethyl-4-phenyldiazenylphenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136995279) has the molecular formula C38H33N7O5S and a molecular weight of 699.79 g/mol. Its IUPAC name is 7-anilino-3-[[4-[(2,5-dimethyl-4-phenyldiazenylphenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-anilino-3-[[4-[(2,5-dimethyl-4-phenyldiazenylphenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136995279 |
| Molecular Formula | C38H33N7O5S |
| Molecular Weight | 699.79 g/mol |
| Exact Mass | 699.23 |
| IUPAC Name | 7-anilino-3-[[4-[(2,5-dimethyl-4-phenyldiazenylphenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | COc1cc(/N=N/c2cc(C)c(/N=N/c3ccccc3)cc2C)c(C)cc1/N=N/c1c(S(=O)(=O)O)cc2cc(Nc3ccccc3)ccc2c1O |
| InChI | InChI=1S/C38H33N7O5S/c1-23-18-32(24(2)17-31(23)41-40-28-13-9-6-10-14-28)42-43-33-22-35(50-4)34(19-25(33)3)44-45-37-36(51(47,48)49)21-26-20-29(15-16-30(26)38(37)46)39-27-11-7-5-8-12-27/h5-22,39,46H,1-4H3,(H,47,48,49)/b41-40+,43-42+,45-44+ |
| InChIKey | VZERVIPTWDUVSA-WAQXWUKASA-N |
| XLogP | 11.72 |
| TPSA | 170.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.79 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|