C33H24N6O13S3 — CID 137280020
7-[[5-hydroxy-4-[[1-hydroxy-6-[(4-hydroxyphenyl)diazenyl]-3-sulfonaphthalen-2-yl]diazenyl]-2-methoxyphenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 137280020) has the molecular formula C33H24N6O13S3 and a molecular weight of 808.78 g/mol. Its IUPAC name is 7-[[5-hydroxy-4-[[1-hydroxy-6-[(4-hydroxyphenyl)diazenyl]-3-sulfonaphthalen-2-yl]diazenyl]-2-methoxyphenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[[5-hydroxy-4-[[1-hydroxy-6-[(4-hydroxyphenyl)diazenyl]-3-sulfonaphthalen-2-yl]diazenyl]-2-methoxyphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 137280020 |
| Molecular Formula | C33H24N6O13S3 |
| Molecular Weight | 808.78 g/mol |
| Exact Mass | 808.06 |
| IUPAC Name | 7-[[5-hydroxy-4-[[1-hydroxy-6-[(4-hydroxyphenyl)diazenyl]-3-sulfonaphthalen-2-yl]diazenyl]-2-methoxyphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | COc1cc(/N=N/c2c(S(=O)(=O)O)cc3cc(/N=N/c4ccc(O)cc4)ccc3c2O)c(O)cc1/N=N/c1ccc2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C33H24N6O13S3/c1-52-29-16-26(28(41)15-27(29)38-36-21-3-2-17-11-23(53(43,44)45)14-30(25(17)13-21)54(46,47)48)37-39-32-31(55(49,50)51)12-18-10-20(6-9-24(18)33(32)42)35-34-19-4-7-22(40)8-5-19/h2-16,40-42H,1H3,(H,43,44,45)(H,46,47,48)(H,49,50,51)/b35-34+,38-36+,39-37+ |
| InChIKey | PMCOYEHNSHTSCC-XQHDHFLYSA-N |
| XLogP | 8.10 |
| TPSA | 307.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.78 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|