C29H25N5O13S4 — CID 135965419
7-[[4-[[1-hydroxy-6-(methanesulfonamido)-3-sulfonaphthalen-2-yl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 135965419) has the molecular formula C29H25N5O13S4 and a molecular weight of 779.81 g/mol. Its IUPAC name is 7-[[4-[[1-hydroxy-6-(methanesulfonamido)-3-sulfonaphthalen-2-yl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[[4-[[1-hydroxy-6-(methanesulfonamido)-3-sulfonaphthalen-2-yl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 135965419 |
| Molecular Formula | C29H25N5O13S4 |
| Molecular Weight | 779.81 g/mol |
| Exact Mass | 779.03 |
| IUPAC Name | 7-[[4-[[1-hydroxy-6-(methanesulfonamido)-3-sulfonaphthalen-2-yl]diazenyl]-5-methoxy-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | COc1cc(/N=N/c2ccc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3c2)c(C)cc1/N=N/c1c(S(=O)(=O)O)cc2cc(NS(C)(=O)=O)ccc2c1O |
| InChI | InChI=1S/C29H25N5O13S4/c1-15-8-24(32-33-28-27(51(44,45)46)11-17-9-19(34-48(3,36)37)6-7-21(17)29(28)35)25(47-2)14-23(15)31-30-18-5-4-16-10-20(49(38,39)40)13-26(22(16)12-18)50(41,42)43/h4-14,34-35H,1-3H3,(H,38,39,40)(H,41,42,43)(H,44,45,46)/b31-30+,33-32+ |
| InChIKey | PLQGMLRVHWPANP-CJQWSLHQSA-N |
| XLogP | 5.96 |
| TPSA | 288.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.81 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|