C26H17N3Na2O7S2 — CID 135755703
disodium;7-anilino-4-hydroxy-3-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate (PubChem CID 135755703) has the molecular formula C26H17N3Na2O7S2 and a molecular weight of 593.55 g/mol. Its IUPAC name is disodium;7-anilino-4-hydroxy-3-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | disodium;7-anilino-4-hydroxy-3-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 135755703 |
| Molecular Formula | C26H17N3Na2O7S2 |
| Molecular Weight | 593.55 g/mol |
| Exact Mass | 593.03 |
| IUPAC Name | disodium;7-anilino-4-hydroxy-3-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1cc2cc(Nc3ccccc3)ccc2c(O)c1/N=N/c1ccc(S(=O)(=O)[O-])c2ccccc12.[Na+].[Na+] |
| InChI | InChI=1S/C26H19N3O7S2.2Na/c30-26-19-11-10-18(27-17-6-2-1-3-7-17)14-16(19)15-24(38(34,35)36)25(26)29-28-22-12-13-23(37(31,32)33)21-9-5-4-8-20(21)22;;/h1-15,27,30H,(H,31,32,33)(H,34,35,36);;/q;2*+1/p-2/b29-28+;; |
| InChIKey | JYYIOFINPOMYMS-NTDCDQSISA-L |
| XLogP | -0.33 |
| TPSA | 171.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.55 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|