C16H10N2Na2O10S3 — CID 136882093
disodium;5-hydroxy-7-sulfo-6-[(2-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate (PubChem CID 136882093) has the molecular formula C16H10N2Na2O10S3 and a molecular weight of 532.44 g/mol. Its IUPAC name is disodium;5-hydroxy-7-sulfo-6-[(2-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate.
| Compound Name | disodium;5-hydroxy-7-sulfo-6-[(2-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 136882093 |
| Molecular Formula | C16H10N2Na2O10S3 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 531.93 |
| IUPAC Name | disodium;5-hydroxy-7-sulfo-6-[(2-sulfonatophenyl)diazenyl]naphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(O)c(/N=N/c3ccccc3S(=O)(=O)[O-])c(S(=O)(=O)O)cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C16H12N2O10S3.2Na/c19-16-11-6-5-10(29(20,21)22)7-9(11)8-14(31(26,27)28)15(16)18-17-12-3-1-2-4-13(12)30(23,24)25;;/h1-8,19H,(H,20,21,22)(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2/b18-17+;; |
| InChIKey | MSBDZBTXXQMFDO-QIKYXUGXSA-L |
| XLogP | -3.98 |
| TPSA | 213.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|