C16H13N3O10S3 — CID 135966889
3-[(5-amino-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 135966889) has the molecular formula C16H13N3O10S3 and a molecular weight of 503.49 g/mol. Its IUPAC name is 3-[(5-amino-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 3-[(5-amino-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 135966889 |
| Molecular Formula | C16H13N3O10S3 |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 502.98 |
| IUPAC Name | 3-[(5-amino-2-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc(S(=O)(=O)O)c(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)ccc3c2O)c1 |
| InChI | InChI=1S/C16H13N3O10S3/c17-9-1-4-13(31(24,25)26)12(7-9)18-19-15-14(32(27,28)29)6-8-5-10(30(21,22)23)2-3-11(8)16(15)20/h1-7,20H,17H2,(H,21,22,23)(H,24,25,26)(H,27,28,29)/b19-18+ |
| InChIKey | WMQLDBAKTKVFEM-VHEBQXMUSA-N |
| XLogP | 2.28 |
| TPSA | 234.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|