C16H11N5O8S — CID 136880439
7-amino-3-[(2,4-dinitrophenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 136880439) has the molecular formula C16H11N5O8S and a molecular weight of 433.36 g/mol. Its IUPAC name is 7-amino-3-[(2,4-dinitrophenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-amino-3-[(2,4-dinitrophenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136880439 |
| Molecular Formula | C16H11N5O8S |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 7-amino-3-[(2,4-dinitrophenyl)diazenyl]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | Nc1ccc2c(O)c(/N=N/c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C16H11N5O8S/c17-9-1-3-11-8(5-9)6-14(30(27,28)29)15(16(11)22)19-18-12-4-2-10(20(23)24)7-13(12)21(25)26/h1-7,22H,17H2,(H,27,28,29)/b19-18+ |
| InChIKey | IPJAUDWPSKBCOK-VHEBQXMUSA-N |
| XLogP | 3.61 |
| TPSA | 211.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|