C22H16N6O16S4 — CID 135812885
3-[[4-amino-2-(trioxidanylsulfanyl)phenyl]diazenyl]-4,5-dihydroxy-6-[(4-nitro-2-sulfophenyl)diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid (PubChem CID 135812885) has the molecular formula C22H16N6O16S4 and a molecular weight of 748.66 g/mol. Its IUPAC name is 3-[[4-amino-2-(trioxidanylsulfanyl)phenyl]diazenyl]-4,5-dihydroxy-6-[(4-nitro-2-sulfophenyl)diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid.
| Compound Name | 3-[[4-amino-2-(trioxidanylsulfanyl)phenyl]diazenyl]-4,5-dihydroxy-6-[(4-nitro-2-sulfophenyl)diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135812885 |
| Molecular Formula | C22H16N6O16S4 |
| Molecular Weight | 748.66 g/mol |
| Exact Mass | 747.95 |
| IUPAC Name | 3-[[4-amino-2-(trioxidanylsulfanyl)phenyl]diazenyl]-4,5-dihydroxy-6-[(4-nitro-2-sulfophenyl)diazenyl]-7-(trioxidanylsulfanyl)naphthalene-2-sulfonic acid |
| SMILES | Nc1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(SOOO)c(/N=N/c4ccc([N+](=O)[O-])cc4S(=O)(=O)O)c(O)c3c2O)c(SOOO)c1 |
| InChI | InChI=1S/C22H16N6O16S4/c23-10-1-3-12(14(7-10)45-43-41-33)24-27-20-17(48(38,39)40)6-9-5-15(46-44-42-34)19(21(29)18(9)22(20)30)26-25-13-4-2-11(28(31)32)8-16(13)47(35,36)37/h1-8,29-30,33-34H,23H2,(H,35,36,37)(H,38,39,40)/b26-25+,27-24+ |
| InChIKey | UAQYAEWXRKHEAV-BZHOXZENSA-N |
| XLogP | 5.92 |
| TPSA | 345.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|