C23H14N6O17S3 — CID 135980667
2-[[1,8-dihydroxy-7-[(4-nitro-2-sulfophenyl)diazenyl]-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-nitrobenzoic acid (PubChem CID 135980667) has the molecular formula C23H14N6O17S3 and a molecular weight of 742.59 g/mol. Its IUPAC name is 2-[[1,8-dihydroxy-7-[(4-nitro-2-sulfophenyl)diazenyl]-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-nitrobenzoic acid.
| Compound Name | 2-[[1,8-dihydroxy-7-[(4-nitro-2-sulfophenyl)diazenyl]-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 135980667 |
| Molecular Formula | C23H14N6O17S3 |
| Molecular Weight | 742.59 g/mol |
| Exact Mass | 741.96 |
| IUPAC Name | 2-[[1,8-dihydroxy-7-[(4-nitro-2-sulfophenyl)diazenyl]-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])ccc1/N=N/c1c(S(=O)(=O)O)cc2cc(SOOO)c(/N=N/c3ccc([N+](=O)[O-])cc3S(=O)(=O)O)c(O)c2c1O |
| InChI | InChI=1S/C23H14N6O17S3/c30-21-18-9(5-15(47-46-45-38)19(21)26-25-14-4-2-11(29(36)37)8-16(14)48(39,40)41)6-17(49(42,43)44)20(22(18)31)27-24-13-3-1-10(28(34)35)7-12(13)23(32)33/h1-8,30-31,38H,(H,32,33)(H,39,40,41)(H,42,43,44)/b26-25+,27-24+ |
| InChIKey | HTJXDRRLOLJMCM-BZHOXZENSA-N |
| XLogP | 5.52 |
| TPSA | 360.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|