C27H18N4O10S2 — CID 135980683
2-[[1,8-dihydroxy-7-(naphthalen-1-yldiazenyl)-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]benzoic acid (PubChem CID 135980683) has the molecular formula C27H18N4O10S2 and a molecular weight of 622.59 g/mol. Its IUPAC name is 2-[[1,8-dihydroxy-7-(naphthalen-1-yldiazenyl)-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]benzoic acid.
| Compound Name | 2-[[1,8-dihydroxy-7-(naphthalen-1-yldiazenyl)-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 135980683 |
| Molecular Formula | C27H18N4O10S2 |
| Molecular Weight | 622.59 g/mol |
| Exact Mass | 622.05 |
| IUPAC Name | 2-[[1,8-dihydroxy-7-(naphthalen-1-yldiazenyl)-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1/N=N/c1c(S(=O)(=O)O)cc2cc(SOOO)c(/N=N/c3cccc4ccccc34)c(O)c2c1O |
| InChI | InChI=1S/C27H18N4O10S2/c32-25-22-15(12-20(42-41-40-36)23(25)30-28-18-11-5-7-14-6-1-2-8-16(14)18)13-21(43(37,38)39)24(26(22)33)31-29-19-10-4-3-9-17(19)27(34)35/h1-13,32-33,36H,(H,34,35)(H,37,38,39)/b30-28+,31-29+ |
| InChIKey | KEXJQXKVUJCJLK-FUEWEDNTSA-N |
| XLogP | 7.61 |
| TPSA | 220.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.59 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|