C27H19N7O12S2 — CID 136591939
2-[[2-[[7-[(2-carboxyphenyl)diazenyl]-8-hydroxy-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-1-yl]amino]-6-oxo-1H-1,3,5-triazin-4-yl]amino]benzoic acid (PubChem CID 136591939) has the molecular formula C27H19N7O12S2 and a molecular weight of 697.62 g/mol. Its IUPAC name is 2-[[2-[[7-[(2-carboxyphenyl)diazenyl]-8-hydroxy-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-1-yl]amino]-6-oxo-1H-1,3,5-triazin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[2-[[7-[(2-carboxyphenyl)diazenyl]-8-hydroxy-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-1-yl]amino]-6-oxo-1H-1,3,5-triazin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 136591939 |
| Molecular Formula | C27H19N7O12S2 |
| Molecular Weight | 697.62 g/mol |
| Exact Mass | 697.05 |
| IUPAC Name | 2-[[2-[[7-[(2-carboxyphenyl)diazenyl]-8-hydroxy-3-sulfo-6-(trioxidanylsulfanyl)naphthalen-1-yl]amino]-6-oxo-1H-1,3,5-triazin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1/N=N/c1c(SOOO)cc2cc(S(=O)(=O)O)cc(Nc3nc(Nc4ccccc4C(=O)O)nc(=O)[nH]3)c2c1O |
| InChI | InChI=1S/C27H19N7O12S2/c35-22-20-12(10-19(47-46-45-41)21(22)34-33-17-8-4-2-6-15(17)24(38)39)9-13(48(42,43)44)11-18(20)29-26-30-25(31-27(40)32-26)28-16-7-3-1-5-14(16)23(36)37/h1-11,35,41H,(H,36,37)(H,38,39)(H,42,43,44)(H3,28,29,30,31,32,40)/b34-33+ |
| InChIKey | AZNPTFLWMKGDCS-JEIPZWNWSA-N |
| XLogP | 5.00 |
| TPSA | 295.31 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.62 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|