C27H30N8O11S2 — CID 142166382
2-[[8-[[4-amino-6-(carboxymethylamino)-1,3,5-triazin-2-yl]amino]-1-hydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid;2-methylbutane (PubChem CID 142166382) has the molecular formula C27H30N8O11S2 and a molecular weight of 706.72 g/mol. Its IUPAC name is 2-[[8-[[4-amino-6-(carboxymethylamino)-1,3,5-triazin-2-yl]amino]-1-hydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid;2-methylbutane.
| Compound Name | 2-[[8-[[4-amino-6-(carboxymethylamino)-1,3,5-triazin-2-yl]amino]-1-hydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid;2-methylbutane |
|---|---|
| PubChem CID | 142166382 |
| Molecular Formula | C27H30N8O11S2 |
| Molecular Weight | 706.72 g/mol |
| Exact Mass | 706.15 |
| IUPAC Name | 2-[[8-[[4-amino-6-(carboxymethylamino)-1,3,5-triazin-2-yl]amino]-1-hydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid;2-methylbutane |
| SMILES | CCC(C)C.Nc1nc(NCC(=O)O)nc(Nc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)c(/N=N/c4ccccc4C(=O)O)c(O)c23)n1 |
| InChI | InChI=1S/C22H18N8O11S2.C5H12/c23-20-26-21(24-8-15(31)32)28-22(27-20)25-13-7-10(42(36,37)38)5-9-6-14(43(39,40)41)17(18(33)16(9)13)30-29-12-4-2-1-3-11(12)19(34)35;1-4-5(2)3/h1-7,33H,8H2,(H,31,32)(H,34,35)(H,36,37,38)(H,39,40,41)(H4,23,24,25,26,27,28);5H,4H2,1-3H3/b30-29+; |
| InChIKey | IQLHMZVXTCUHKE-BXGDTPBJSA-N |
| XLogP | 4.21 |
| TPSA | 317.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.72 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|