C27H19N7O12S2 — CID 136784489
2-[[2-[7-[(2-carboxyphenyl)diazenyl]-8-hydroxy-3,6-disulfonaphthalen-1-yl]imino-6-hydroxy-1H-1,3,5-triazin-4-ylidene]amino]benzoic acid (PubChem CID 136784489) has the molecular formula C27H19N7O12S2 and a molecular weight of 697.62 g/mol. Its IUPAC name is 2-[[2-[7-[(2-carboxyphenyl)diazenyl]-8-hydroxy-3,6-disulfonaphthalen-1-yl]imino-6-hydroxy-1H-1,3,5-triazin-4-ylidene]amino]benzoic acid.
| Compound Name | 2-[[2-[7-[(2-carboxyphenyl)diazenyl]-8-hydroxy-3,6-disulfonaphthalen-1-yl]imino-6-hydroxy-1H-1,3,5-triazin-4-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 136784489 |
| Molecular Formula | C27H19N7O12S2 |
| Molecular Weight | 697.62 g/mol |
| Exact Mass | 697.05 |
| IUPAC Name | 2-[[2-[7-[(2-carboxyphenyl)diazenyl]-8-hydroxy-3,6-disulfonaphthalen-1-yl]imino-6-hydroxy-1H-1,3,5-triazin-4-ylidene]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1/N=N/c1c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(/N=c3/[nH]c(O)n/c(=N\c4ccccc4C(=O)O)[nH]3)c2c1O |
| InChI | InChI=1S/C27H19N7O12S2/c35-22-20-12(10-19(48(44,45)46)21(22)34-33-17-8-4-2-6-15(17)24(38)39)9-13(47(41,42)43)11-18(20)29-26-30-25(31-27(40)32-26)28-16-7-3-1-5-14(16)23(36)37/h1-11,35H,(H,36,37)(H,38,39)(H,41,42,43)(H,44,45,46)(H3,28,29,30,31,32,40)/b34-33+ |
| InChIKey | ZBSNVMURHJTEMX-JEIPZWNWSA-N |
| XLogP | 3.07 |
| TPSA | 317.71 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.62 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|