C20H15N3O13S3 — CID 136771305
(E)-4-[[8-hydroxy-3,6-disulfo-7-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 136771305) has the molecular formula C20H15N3O13S3 and a molecular weight of 601.55 g/mol. Its IUPAC name is (E)-4-[[8-hydroxy-3,6-disulfo-7-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[8-hydroxy-3,6-disulfo-7-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 136771305 |
| Molecular Formula | C20H15N3O13S3 |
| Molecular Weight | 601.55 g/mol |
| Exact Mass | 600.98 |
| IUPAC Name | (E)-4-[[8-hydroxy-3,6-disulfo-7-[(2-sulfophenyl)diazenyl]naphthalen-1-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccccc3S(=O)(=O)O)c(O)c12 |
| InChI | InChI=1S/C20H15N3O13S3/c24-16(5-6-17(25)26)21-13-9-11(37(28,29)30)7-10-8-15(39(34,35)36)19(20(27)18(10)13)23-22-12-3-1-2-4-14(12)38(31,32)33/h1-9,27H,(H,21,24)(H,25,26)(H,28,29,30)(H,31,32,33)(H,34,35,36)/b6-5+,23-22+ |
| InChIKey | WYAXXLLHODPWEM-KSAZOEPLSA-N |
| XLogP | 2.28 |
| TPSA | 274.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|