C18H14N4O10S2 — CID 136804162
5-acetamido-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 136804162) has the molecular formula C18H14N4O10S2 and a molecular weight of 510.46 g/mol. Its IUPAC name is 5-acetamido-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-acetamido-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136804162 |
| Molecular Formula | C18H14N4O10S2 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | 5-acetamido-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccc([N+](=O)[O-])cc3)c(O)c12 |
| InChI | InChI=1S/C18H14N4O10S2/c1-9(23)19-14-8-13(33(27,28)29)6-10-7-15(34(30,31)32)17(18(24)16(10)14)21-20-11-2-4-12(5-3-11)22(25)26/h2-8,24H,1H3,(H,19,23)(H,27,28,29)(H,30,31,32)/b21-20+ |
| InChIKey | PADHNURPYDBGFA-QZQOTICOSA-N |
| XLogP | 3.32 |
| TPSA | 225.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|