C16H11N3O9S2 — CID 136845587
4-hydroxy-5-nitro-3-phenyldiazenylnaphthalene-2,7-disulfonic acid (PubChem CID 136845587) has the molecular formula C16H11N3O9S2 and a molecular weight of 453.41 g/mol. Its IUPAC name is 4-hydroxy-5-nitro-3-phenyldiazenylnaphthalene-2,7-disulfonic acid.
| Compound Name | 4-hydroxy-5-nitro-3-phenyldiazenylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136845587 |
| Molecular Formula | C16H11N3O9S2 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 4-hydroxy-5-nitro-3-phenyldiazenylnaphthalene-2,7-disulfonic acid |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(/N=N/c3ccccc3)c(O)c12 |
| InChI | InChI=1S/C16H11N3O9S2/c20-16-14-9(6-11(29(23,24)25)8-12(14)19(21)22)7-13(30(26,27)28)15(16)18-17-10-4-2-1-3-5-10/h1-8,20H,(H,23,24,25)(H,26,27,28)/b18-17+ |
| InChIKey | LERGRMFQVZFACK-ISLYRVAYSA-N |
| XLogP | 3.36 |
| TPSA | 196.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|