C28H17N9O16S2 — CID 54736299
5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)diazenyl]phenyl]diazenyl]-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 54736299) has the molecular formula C28H17N9O16S2 and a molecular weight of 799.62 g/mol. Its IUPAC name is 5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)diazenyl]phenyl]diazenyl]-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)diazenyl]phenyl]diazenyl]-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 54736299 |
| Molecular Formula | C28H17N9O16S2 |
| Molecular Weight | 799.62 g/mol |
| Exact Mass | 799.02 |
| IUPAC Name | 5-[[2,4-dihydroxy-5-[(2-hydroxy-3,5-dinitrophenyl)diazenyl]phenyl]diazenyl]-4-hydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2c(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(/N=N/c4cc(/N=N/c5cc([N+](=O)[O-])cc([N+](=O)[O-])c5O)c(O)cc4O)c3c2O)cc1 |
| InChI | InChI=1S/C28H17N9O16S2/c38-22-11-23(39)18(31-33-20-7-15(36(44)45)8-21(27(20)40)37(46)47)10-17(22)30-32-19-9-16(54(48,49)50)5-12-6-24(55(51,52)53)26(28(41)25(12)19)34-29-13-1-3-14(4-2-13)35(42)43/h1-11,38-41H,(H,48,49,50)(H,51,52,53)/b32-30+,33-31+,34-29+ |
| InChIKey | RTHCEHLXMOJXJN-PKDJZJALSA-N |
| XLogP | 7.13 |
| TPSA | 393.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|